| Name |
N-(2-{5,7-dioxo-5H,6H,7H-pyrrolo[3,4-b]pyridin-6-yl}ethyl)-2-(2-oxo-2,3-dihydro-1,3-benzoxazol-3-yl)acetamide
|
| Molecular Formula |
C18H14N4O5
|
| Molecular Weight |
366.3
|
| Smiles |
O=C(Cn1c(=O)oc2ccccc21)NCCN1C(=O)c2cccnc2C1=O
|
O=C(Cn1c(=O)oc2ccccc21)NCCN1C(=O)c2cccnc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.