| Name |
1-(1,1-Dioxido-7-phenyl-1,4-thiazepan-4-yl)-3,3,3-trifluoropropan-1-one
|
| Molecular Formula |
C14H16F3NO3S
|
| Molecular Weight |
335.34
|
| Smiles |
O=C(CC(F)(F)F)N1CCC(c2ccccc2)S(=O)(=O)CC1
|
O=C(CC(F)(F)F)N1CCC(c2ccccc2)S(=O)(=O)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.