| Name |
tert-butyl 2-{2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-7-yl}acetate
|
| Molecular Formula |
C12H13Cl2N3O2
|
| Molecular Weight |
302.15
|
| Smiles |
CC(C)(C)OC(=O)Cn1ccc2c(Cl)nc(Cl)nc21
|
CC(C)(C)OC(=O)Cn1ccc2c(Cl)nc(Cl)nc21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.