| Name |
5-(Phenylsulfonyl)-4,5-dihydro-1H-pyrrolo[3,2-c:4,5-c']dipyridin-3(2H)-one
|
| Molecular Formula |
C16H13N3O3S
|
| Molecular Weight |
327.4
|
| Smiles |
O=C1Cc2c(c3cnccc3n2S(=O)(=O)c2ccccc2)CN1
|
O=C1Cc2c(c3cnccc3n2S(=O)(=O)c2ccccc2)CN1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.