| Name |
N-((8-ethoxy-[1,2,4]triazolo[4,3-a]pyrazin-3-yl)methyl)-2-(trifluoromethoxy)benzamide
|
| Molecular Formula |
C16H14F3N5O3
|
| Molecular Weight |
381.31
|
| Smiles |
CCOc1nccn2c(CNC(=O)c3ccccc3OC(F)(F)F)nnc12
|
CCOc1nccn2c(CNC(=O)c3ccccc3OC(F)(F)F)nnc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.