| Name |
Ethyl 2-(3,5-difluoropyridin-2-yl)-2,2-difluoroacetate
|
| Molecular Formula |
C9H7F4NO2
|
| Molecular Weight |
237.15
|
| Smiles |
CCOC(=O)C(F)(F)c1ncc(F)cc1F
|
CCOC(=O)C(F)(F)c1ncc(F)cc1F
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.