| Name | 6-(2,6-dichloro-3,5-dimethoxyphenyl)-2-(methylthio)pyrido[2,3-d]pyrimidin-7(8H)-one | 
                        
                        
                        
                    
                 
                
                
                    
                        
                        
                            | Molecular Formula | C16H13Cl2N3O3S | 
                        
                        
                            | Molecular Weight | 398.3 | 
                        
                        
                            | Smiles | COc1cc(OC)c(Cl)c(-c2cc3cnc(SC)nc3[nH]c2=O)c1Cl | 
                        
                        
                    
                 
                
                
                
                
                
                
                
                    
                        COc1cc(OC)c(Cl)c(-c2cc3cnc(SC)nc3[nH]c2=O)c1Cl
                    
                 
                
                
                The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.