| Name |
methyl 1-{[(4-methyl-1,3-thiazol-2-yl)carbamoyl]methyl}-1H-1,2,3-triazole-4-carboxylate
|
| Molecular Formula |
C10H11N5O3S
|
| Molecular Weight |
281.29
|
| Smiles |
COC(=O)c1cn(CC(=O)Nc2nc(C)cs2)nn1
|
COC(=O)c1cn(CC(=O)Nc2nc(C)cs2)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.