| Name |
4-Phenyl-2,4,5,6-tetrahydropyrrolo[2,3-c]pyrazol-3-ol
|
| Molecular Formula |
C11H11N3O
|
| Molecular Weight |
201.22
|
| Smiles |
O=c1[nH][nH]c2c1C(c1ccccc1)CN2
|
O=c1[nH][nH]c2c1C(c1ccccc1)CN2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.