| Name |
1H-1,2,4-Triazole-5-carboxylic acid, 3-(4-fluorophenyl)-, ethyl ester
|
| Molecular Formula |
C11H10FN3O2
|
| Molecular Weight |
235.21
|
| Smiles |
CCOC(=O)c1nc(-c2ccc(F)cc2)n[nH]1
|
CCOC(=O)c1nc(-c2ccc(F)cc2)n[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.