| Name |
(3aR,8aR)-2,2-Dimethyl-4,4,8,8-tetraphenyl-N,N-bis((R)-1-phenylethyl)tetrahydro-[1,3]dioxolo[4,5-e][1,3,2]dioxaphosphepin-6-amine
|
| Molecular Formula |
C47H46NO4P
|
| Molecular Weight |
719.8
|
| Smiles |
CC(c1ccccc1)N(C(C)c1ccccc1)P1OC(c2ccccc2)(c2ccccc2)C2OC(C)(C)OC2C(c2ccccc2)(c2ccccc2)O1
|
CC(c1ccccc1)N(C(C)c1ccccc1)P1OC(c2ccccc2)(c2ccccc2)C2OC(C)(C)OC2C(c2ccccc2)(c2ccccc2)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.