| Name |
(1S)-1-(3,5-Dimethoxyphenyl)-2,2,2-trifluoroethanamine
|
| Molecular Formula |
C10H12F3NO2
|
| Molecular Weight |
235.20
|
| Smiles |
COc1cc(OC)cc(C(N)C(F)(F)F)c1
|
COc1cc(OC)cc(C(N)C(F)(F)F)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.