| Name |
{5H,6H,7H,8H-[1,2,4]triazolo[4,3-a]pyridin-3-yl}methanesulfonyl chloride
|
| Molecular Formula |
C7H10ClN3O2S
|
| Molecular Weight |
235.69
|
| Smiles |
O=S(=O)(Cl)Cc1nnc2n1CCCC2
|
O=S(=O)(Cl)Cc1nnc2n1CCCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.