| Name |
Ethyl 4-[[6-(imidazo[1,2-d][1,2,4]thiadiazol-3-ylamino)hexyl](1-naphthylsulfonyl)-amino]butanoate
|
| Molecular Formula |
C26H33N5O4S2
|
| Molecular Weight |
543.7
|
| Smiles |
CCOC(=O)CCCN(CCCCCCNc1nsc2nccn12)S(=O)(=O)c1cccc2ccccc12
|
CCOC(=O)CCCN(CCCCCCNc1nsc2nccn12)S(=O)(=O)c1cccc2ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.