| Name |
2-(2-Methylpropanoyl)-2,3-dihydro-1H-inden-1-one
|
| Molecular Formula |
C13H14O2
|
| Molecular Weight |
202.25
|
| Smiles |
CC(C)C(=O)C1Cc2ccccc2C1=O
|
CC(C)C(=O)C1Cc2ccccc2C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.