| Name |
2-(7-Cyclobutyl-5-oxo-3,5-dihydro-2H-thiazolo[3,2-a]pyrimidin-3-yl)acetic acid
|
| Molecular Formula |
C12H14N2O3S
|
| Molecular Weight |
266.32
|
| Smiles |
O=C(O)CC1CSc2nc(C3CCC3)cc(=O)n21
|
O=C(O)CC1CSc2nc(C3CCC3)cc(=O)n21
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.