| Name |
(1R,2R,5R,6S,9S,10R)-1,2,5,6,9,10-hexabromo(1,2,3,4,5,6,7,8,9,10,11,12-13C12)cyclododecane
|
| Molecular Formula |
C12H18Br6
|
| Molecular Weight |
653.6
|
| Smiles |
BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br
|
BrC1CCC(Br)C(Br)CCC(Br)C(Br)CCC1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.