| Name |
[1,4a(2)-Bipiperidin]-4-ol, 1a(2)-(phenylmethyl)-, 4-acetate
|
| Molecular Formula |
C19H28N2O2
|
| Molecular Weight |
316.4
|
| Smiles |
CC(=O)OC1CCN(C2CCN(Cc3ccccc3)CC2)CC1
|
CC(=O)OC1CCN(C2CCN(Cc3ccccc3)CC2)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.