| Name |
2,2',2''-(10-(((2-Carboxyethyl)(hydroxy)phosphoryl)methyl)-1,4,7,10-tetraazacyclododecane-1,4,7-triyl)triacetic acid
|
| Molecular Formula |
C18H33N4O10P
|
| Molecular Weight |
496.4
|
| Smiles |
O=C(O)CCP(=O)(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1
|
O=C(O)CCP(=O)(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.