| Name |
2,7-dimethyl-5-(trifluoromethyl)-2H,3H,5H,6H,7H,8H-imidazo[1,2-a]pyrimidine
|
| Molecular Formula |
C9H14F3N3
|
| Molecular Weight |
221.22
|
| Smiles |
CC1CC(C(F)(F)F)N2CC(C)NC2=N1
|
CC1CC(C(F)(F)F)N2CC(C)NC2=N1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.