| Name |
3-(Naphthalen-2-yl)-1,2,4-oxadiazole-5-thiol
|
| Molecular Formula |
C12H8N2OS
|
| Molecular Weight |
228.27
|
| Smiles |
S=c1nc(-c2ccc3ccccc3c2)[nH]o1
|
S=c1nc(-c2ccc3ccccc3c2)[nH]o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.