| Name |
(1R,3R)-1-(1,3-benzodioxol-5-yl)-2-(2-chloroacetyl)-2,3,4,9-tetrahydro-1H-Pyrido[3,4-b]indole-3-carboxylic acid
|
| Molecular Formula |
C21H17ClN2O5
|
| Molecular Weight |
412.8
|
| Smiles |
O=C(O)C1Cc2c([nH]c3ccccc23)C(c2ccc3c(c2)OCO3)N1C(=O)CCl
|
O=C(O)C1Cc2c([nH]c3ccccc23)C(c2ccc3c(c2)OCO3)N1C(=O)CCl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.