| Name |
Benzoic acid, 2,4-dihydroxy-6-methyl-, 3-formyl-2,2a,4a,5,6,7,7a,7b-octahydro-2a,7-dihydroxy-6,6,7b-trimethyl-1H-cyclobut[e]inden-2-yl ester, [2R-(2I+/-,2aI+/-,4aI+/-,7I(2),7aI+/-,7bI(2))]-
|
| Molecular Formula |
C23H28O7
|
| Molecular Weight |
416.5
|
| Smiles |
Cc1cc(O)cc(O)c1C(=O)OC1CC2(C)C3C(C=C(C=O)C12O)CC(C)(C)C3O
|
Cc1cc(O)cc(O)c1C(=O)OC1CC2(C)C3C(C=C(C=O)C12O)CC(C)(C)C3O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.