| Name |
Ethyl 2-(4,5-dimethyl-2-(4H-1,2,4-triazol-4-yl)phenoxy)acetate
|
| Molecular Formula |
C14H17N3O3
|
| Molecular Weight |
275.30
|
| Smiles |
CCOC(=O)COc1cc(C)c(C)cc1-n1cnnc1
|
CCOC(=O)COc1cc(C)c(C)cc1-n1cnnc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.