| Name |
3,6-Dihydro-8-(1-methylethyl)-1,3,6-trioxo[1]benzothiopyrano[2,3-e]isoindol-2-yl perfluorobutanesulfonate
|
| Molecular Formula |
C22H12F9NO6S2
|
| Molecular Weight |
621.5
|
| Smiles |
CC(C)c1ccc2sc3c4c(ccc3c(=O)c2c1)C(=O)N(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C4=O
|
CC(C)c1ccc2sc3c4c(ccc3c(=O)c2c1)C(=O)N(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C4=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.