| Name |
1h-Indole-5-carboxamide,n-[(4-bromophenyl)methyl]-2,3-dihydro-n-methyl-
|
| Molecular Formula |
C17H17BrN2O
|
| Molecular Weight |
345.2
|
| Smiles |
CN(Cc1ccc(Br)cc1)C(=O)c1ccc2c(c1)CCN2
|
CN(Cc1ccc(Br)cc1)C(=O)c1ccc2c(c1)CCN2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.