| Name |
Benzeneacetic acid, 2,6-dichloro-3,4,5-trimethoxy-alpha-oxo-, methyl ester
|
| Molecular Formula |
C12H12Cl2O6
|
| Molecular Weight |
323.12
|
| Smiles |
COC(=O)C(=O)c1c(Cl)c(OC)c(OC)c(OC)c1Cl
|
COC(=O)C(=O)c1c(Cl)c(OC)c(OC)c(OC)c1Cl
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.