| Name |
(1R)-Potassium 3,3'-diphenyl-[1,1'-binaphthalene]-2,2'-disulfonate
|
| Molecular Formula |
C32H20K2O6S2
|
| Molecular Weight |
642.8
|
| Smiles |
O=S(=O)([O-])c1c(-c2ccccc2)cc2ccccc2c1-c1c(S(=O)(=O)[O-])c(-c2ccccc2)cc2ccccc12.[K+].[K+]
|
O=S(=O)([O-])c1c(-c2ccccc2)cc2ccccc2c1-c1c(S(=O)(=O)[O-])c(-c2ccccc2)cc2ccccc12.[K+].[K+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.