| Name |
2-Amino-2-methyl-4-(1h-1,2,4-triazol-1-yl)pentanoic acid
|
| Molecular Formula |
C8H14N4O2
|
| Molecular Weight |
198.22
|
| Smiles |
CC(CC(C)(N)C(=O)O)n1cncn1
|
CC(CC(C)(N)C(=O)O)n1cncn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.