| Name |
2,5-Dibenzyl-3,6-bis[4-(morpholin-4-yl)phenyl]-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione
|
| Molecular Formula |
C40H38N4O4
|
| Molecular Weight |
638.8
|
| Smiles |
O=C1C2=C(c3ccc(N4CCOCC4)cc3)N(Cc3ccccc3)C(=O)C2=C(c2ccc(N3CCOCC3)cc2)N1Cc1ccccc1
|
O=C1C2=C(c3ccc(N4CCOCC4)cc3)N(Cc3ccccc3)C(=O)C2=C(c2ccc(N3CCOCC3)cc2)N1Cc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.