| Name |
N-(4-tert-butyl-1,3-thiazol-2-yl)-2,5-dimethyl-1,3-thiazole-4-carboxamide
|
| Molecular Formula |
C13H17N3OS2
|
| Molecular Weight |
295.4
|
| Smiles |
Cc1nc(C(=O)Nc2nc(C(C)(C)C)cs2)c(C)s1
|
Cc1nc(C(=O)Nc2nc(C(C)(C)C)cs2)c(C)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.