| Name |
4-Chloro-2-(2,5-dichlorophenyl)-5,6-dimethylpyrimidine
|
| Molecular Formula |
C12H9Cl3N2
|
| Molecular Weight |
287.6
|
| Smiles |
Cc1nc(-c2cc(Cl)ccc2Cl)nc(Cl)c1C
|
Cc1nc(-c2cc(Cl)ccc2Cl)nc(Cl)c1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.