| Name |
4-Bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline
|
| Molecular Formula |
C12H17BBrNO2
|
| Molecular Weight |
297.99
|
| Smiles |
CC1(C)OB(c2cc(Br)ccc2N)OC1(C)C
|
CC1(C)OB(c2cc(Br)ccc2N)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.