| Name |
(12bS,12'bS)-12b,12'b-Dimethyl-2,2',3,3'-tetrahydro-1H,1'H-[9,9'-bitetrapheno[5,4-bc]furan]-6,6',8,8',11,11'(12bH,12'bH)-hexaone
|
| Molecular Formula |
C40H26O8
|
| Molecular Weight |
634.6
|
| Smiles |
CC12CCCc3coc(c31)C(=O)c1cc3c(cc12)C(=O)C=C(C1=CC(=O)c2cc4c(cc2C1=O)C(=O)c1occ2c1C4(C)CCC2)C3=O
|
CC12CCCc3coc(c31)C(=O)c1cc3c(cc12)C(=O)C=C(C1=CC(=O)c2cc4c(cc2C1=O)C(=O)c1occ2c1C4(C)CCC2)C3=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.