| Name |
N-(2-bromophenyl)-3-phenyl-5,6-dihydro-1,4-oxathiine-2-carboxamide 4,4-dioxide
|
| Molecular Formula |
C17H14BrNO4S
|
| Molecular Weight |
408.3
|
| Smiles |
O=C(Nc1ccccc1Br)C1=C(c2ccccc2)S(=O)(=O)CCO1
|
O=C(Nc1ccccc1Br)C1=C(c2ccccc2)S(=O)(=O)CCO1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.