| Name |
N-[2-[(2,6-Difluorophenyl)amino]-2-oxoethyl]-N-ethylthieno[2a(2),3a(2):4,5]imidazo[2,1-b]thiazole-2-carboxamide
|
| Molecular Formula |
C18H14F2N4O2S2
|
| Molecular Weight |
420.5
|
| Smiles |
CCN(CC(=O)Nc1c(F)cccc1F)C(=O)c1cc2c(nc3sccn32)s1
|
CCN(CC(=O)Nc1c(F)cccc1F)C(=O)c1cc2c(nc3sccn32)s1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.