| Name |
5-({[4-(4-Chlorophenyl)-1,3-thiazol-2-yl]sulfanyl}methyl)furan-2-carboxylic acid
|
| Molecular Formula |
C15H10ClNO3S2
|
| Molecular Weight |
351.8
|
| Smiles |
O=C(O)c1ccc(CSc2nc(-c3ccc(Cl)cc3)cs2)o1
|
O=C(O)c1ccc(CSc2nc(-c3ccc(Cl)cc3)cs2)o1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.