| Name |
10-Ethyl-2,3,6,7,10,13,17,20,21-nonamethyldocosane
|
| Molecular Formula |
C33H68
|
| Molecular Weight |
464.9
|
| Smiles |
CCC(C)(CCC(C)CCCC(C)CCC(C)C(C)C)CCC(C)C(C)CCC(C)C(C)C
|
CCC(C)(CCC(C)CCCC(C)CCC(C)C(C)C)CCC(C)C(C)CCC(C)C(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.