| Name |
14-(3-Morpholin-4-ylpropyl)-13-(3-propan-2-yloxyphenyl)-17-oxa-14-azatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,8,12(16)-hexaene-11,15-dione
|
| Molecular Formula |
C31H32N2O5
|
| Molecular Weight |
512.6
|
| Smiles |
CC(C)Oc1cccc(C2c3c(oc4c(ccc5ccccc54)c3=O)C(=O)N2CCCN2CCOCC2)c1
|
CC(C)Oc1cccc(C2c3c(oc4c(ccc5ccccc54)c3=O)C(=O)N2CCCN2CCOCC2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.