| Name |
3-[(3aR,6aS)-5'-fluoro-2',4,6-trioxo-5-(2-phenylethyl)spiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]propanoic acid
|
| Molecular Formula |
C24H22FN3O5
|
| Molecular Weight |
451.4
|
| Smiles |
O=C(O)CCC1NC2(C(=O)Nc3ccc(F)cc32)C2C(=O)N(CCc3ccccc3)C(=O)C12
|
O=C(O)CCC1NC2(C(=O)Nc3ccc(F)cc32)C2C(=O)N(CCc3ccccc3)C(=O)C12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.