| Name |
2-[(3aR,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-5'-fluoro-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl]acetamide
|
| Molecular Formula |
C23H19FN4O6
|
| Molecular Weight |
466.4
|
| Smiles |
NC(=O)CC1NC2(C(=O)Nc3ccc(F)cc32)C2C(=O)N(Cc3ccc4c(c3)OCO4)C(=O)C12
|
NC(=O)CC1NC2(C(=O)Nc3ccc(F)cc32)C2C(=O)N(Cc3ccc4c(c3)OCO4)C(=O)C12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.