| Name |
2-(9-fluoro-5-oxo-2,3-dihydro[1,3]thiazolo[3',2':1,2]pyrimido[5,4-b]indol-6(5H)-yl)-N-(3-phenylpropyl)acetamide
|
| Molecular Formula |
C23H21FN4O2S
|
| Molecular Weight |
436.5
|
| Smiles |
O=C(Cn1c2ccc(F)cc2c2nc3n(c(=O)c21)CCS3)NCCCc1ccccc1
|
O=C(Cn1c2ccc(F)cc2c2nc3n(c(=O)c21)CCS3)NCCCc1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.