| Name |
8-butyl-3-[(2,4-dichlorophenyl)methyl]-1,7-dimethyl-1H,2H,3H,4H,8H-imidazo[1,2-g]purine-2,4-dione
|
| Molecular Formula |
C20H21Cl2N5O2
|
| Molecular Weight |
434.3
|
| Smiles |
CCCCn1c(C)cn2c3c(=O)n(Cc4ccc(Cl)cc4Cl)c(=O)n(C)c3nc12
|
CCCCn1c(C)cn2c3c(=O)n(Cc4ccc(Cl)cc4Cl)c(=O)n(C)c3nc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.