| Name |
(3S,4aR,7aS,8aS,8bS,11R,11aR,13aS,13bR)-3-Hydroxy-11a,13b-dimethyl-11-[(2R)-6-methylheptan-2-yl]hexadecahydro-6H-cyclopenta[1,2]phenanthro[9,8a-d][1,3]oxathiole-6-thione
|
| Molecular Formula |
C28H46O2S2
|
| Molecular Weight |
478.8
|
| Smiles |
CC(C)CCCC(C)C1CCC2C3CC4SC(=S)OC45CC(O)CCC5(C)C3CCC12C
|
CC(C)CCCC(C)C1CCC2C3CC4SC(=S)OC45CC(O)CCC5(C)C3CCC12C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.