| Name |
1-methyl-N-(3,3,5-trimethylcyclohexyl)pyrazolo[3,4-d]pyrimidin-4-amine
|
| Molecular Formula |
C15H23N5
|
| Molecular Weight |
273.38
|
| Smiles |
CC1CC(Nc2ncnc3c2cnn3C)CC(C)(C)C1
|
CC1CC(Nc2ncnc3c2cnn3C)CC(C)(C)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.