| Name |
2-[7-(4-chlorophenyl)-1,3-dimethyl-2,4-dioxo-pyrimido[4,5-d]pyrimidin-5-yl]sulfanyl-N-thiazol-2-yl-acetamide
|
| Molecular Formula |
C19H15ClN6O3S2
|
| Molecular Weight |
474.9
|
| Smiles |
Cn1c(=O)c2c(SCC(=O)Nc3nccs3)nc(-c3ccc(Cl)cc3)nc2n(C)c1=O
|
Cn1c(=O)c2c(SCC(=O)Nc3nccs3)nc(-c3ccc(Cl)cc3)nc2n(C)c1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.