| Name |
(1R,5S)-11-Chloro-1,2,3,4,5,6-hexahydro-1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one
|
| Molecular Formula |
C11H13ClN2O
|
| Molecular Weight |
224.68
|
| Smiles |
O=c1ccc(Cl)c2n1CC1CNCC2C1
|
O=c1ccc(Cl)c2n1CC1CNCC2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.