| Name |
(1S,2R)-5,9-dihydroxy-2-(2-hydroxypropan-2-yl)-1-(1-hydroxy-3,5,6-trimethoxy-9-oxo-10H-acridin-2-yl)-10-methoxy-11-methyl-1,2-dihydrofuro[2,3-c]acridin-6-one
|
| Molecular Formula |
C36H34N2O11
|
| Molecular Weight |
670.7
|
| Smiles |
COc1cc2[nH]c3c(OC)c(OC)ccc3c(=O)c2c(O)c1C1c2c(cc(O)c3c(=O)c4ccc(O)c(OC)c4n(C)c23)OC1C(C)(C)O
|
COc1cc2[nH]c3c(OC)c(OC)ccc3c(=O)c2c(O)c1C1c2c(cc(O)c3c(=O)c4ccc(O)c(OC)c4n(C)c23)OC1C(C)(C)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.