| Name |
6-(4-chlorobenzyl)-5-((2,5-dimethylbenzyl)thio)-2-ethyl-2H-pyrazolo[4,3-d]pyrimidin-7(6H)-one
|
| Molecular Formula |
C23H23ClN4OS
|
| Molecular Weight |
439.0
|
| Smiles |
CCn1cc2nc(SCc3cc(C)ccc3C)n(Cc3ccc(Cl)cc3)c(=O)c2n1
|
CCn1cc2nc(SCc3cc(C)ccc3C)n(Cc3ccc(Cl)cc3)c(=O)c2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.