| Name |
Dimethyl 4-(3,4-dimethoxyphenyl)-5,6,7-trimethoxy-1-(methoxymethoxy)naphthalene-2,3-dicarboxylate
|
| Molecular Formula |
C27H30O11
|
| Molecular Weight |
530.5
|
| Smiles |
COCOc1c(C(=O)OC)c(C(=O)OC)c(-c2ccc(OC)c(OC)c2)c2c(OC)c(OC)c(OC)cc12
|
COCOc1c(C(=O)OC)c(C(=O)OC)c(-c2ccc(OC)c(OC)c2)c2c(OC)c(OC)c(OC)cc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.